4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride
4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride
CAS: 144235-64-3
Molecular Formula: C9H11ClN4
4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride - Names and Identifiers
| Name | 4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride |
| Synonyms | [119192-10-8], C9H10N4,174.20 4-(1,2,4-Triazolylmethyl)phenylamine hydrochloride 4-(1H-1,2,4-Triazol-1-Ylmethyl)AnilineHydrochloride 4-(1,2,4-Triazolylmethyl)phenylamine hydrochloride 4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride Benzenamine, 4-(1H-1,2,4-triazol-1-ylmethyl)-, hydrochloride |
| CAS | 144235-64-3 |
| InChI | InChI=1/C9H10N4.ClH/c10-9-3-1-8(2-4-9)5-13-7-11-6-12-13;/h1-4,6-7H,5,10H2;1H |
4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride - Physico-chemical Properties
| Molecular Formula | C9H11ClN4 |
| Molar Mass | 210.66 |
| Melting Point | 173-182°C |
| Boling Point | 402.1°C at 760 mmHg |
| Flash Point | 197°C |
| Vapor Presure | 1.12E-06mmHg at 25°C |
4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride - Introduction
4-(1H-1,2,4-triazol-1-ylmethyl) benzenamine hydrochloride, chemical name is 4-[1H-1,2,4-triazol-1-ylmethyl]aniline hydrochloride.
The properties of this compound include:
1. Appearance: white crystalline powder
2. Solubility: soluble in water and organic solvents (such as ethanol, acetone, etc.)
3. Melting Point: about 180-185 ° C
4. Chemical properties: in the chemical reaction, it can react with other compounds such as condensation and substitution.
The main use of 4-(1H-1, 2,4-triazol-1-ylmethyl) benzenamine hydrochloride is as an organic synthesis intermediate. It can be used to synthesize various organic compounds, such as drugs, dyes and pesticides.
The preparation method of the compound can be obtained by reacting benzylamine (benzylamine) and 1H-1, 2,4-triazole -1-methanol (1H-1,2,4-triazol-1-ylmethanol), add hydrochloric acid to obtain. Specific reaction conditions and steps need to be adjusted and optimized according to experimental requirements.
Regarding safety information, the toxicity and safety instructions of this compound need to be evaluated according to specific experimental conditions. Generally speaking, strict safety measures should be taken in chemical experiments, and personal protection should be paid to avoid contact with skin, eyes or inhalation of vapors. If necessary, use appropriate protective equipment such as gloves, glasses and ventilation equipment. When using and handling the compound, the relevant chemical experimental practice and safety management requirements should be followed.
The properties of this compound include:
1. Appearance: white crystalline powder
2. Solubility: soluble in water and organic solvents (such as ethanol, acetone, etc.)
3. Melting Point: about 180-185 ° C
4. Chemical properties: in the chemical reaction, it can react with other compounds such as condensation and substitution.
The main use of 4-(1H-1, 2,4-triazol-1-ylmethyl) benzenamine hydrochloride is as an organic synthesis intermediate. It can be used to synthesize various organic compounds, such as drugs, dyes and pesticides.
The preparation method of the compound can be obtained by reacting benzylamine (benzylamine) and 1H-1, 2,4-triazole -1-methanol (1H-1,2,4-triazol-1-ylmethanol), add hydrochloric acid to obtain. Specific reaction conditions and steps need to be adjusted and optimized according to experimental requirements.
Regarding safety information, the toxicity and safety instructions of this compound need to be evaluated according to specific experimental conditions. Generally speaking, strict safety measures should be taken in chemical experiments, and personal protection should be paid to avoid contact with skin, eyes or inhalation of vapors. If necessary, use appropriate protective equipment such as gloves, glasses and ventilation equipment. When using and handling the compound, the relevant chemical experimental practice and safety management requirements should be followed.
Last Update：2024-04-09 20:02:46
